About 2,7-dimethyl-2,7-diazaspiro[3.4]octane;2-methyl-6-oxa-2-azaspiro[3.4]octane
2,7-dimethyl-2,7-diazaspiro[3.4]octane;2-methyl-6-oxa-2-azaspiro[3.4]octane (PubChem CID 166170976) has the molecular formula C15H29N3O
and a molecular weight of 267.42 g/mol. Its IUPAC name is 2,7-dimethyl-2,7-diazaspiro[3.4]octane;2-methyl-6-oxa-2-azaspiro[3.4]octane.
Molecular Properties
| Compound Name | 2,7-dimethyl-2,7-diazaspiro[3.4]octane;2-methyl-6-oxa-2-azaspiro[3.4]octane |
| PubChem CID | 166170976 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | 2,7-dimethyl-2,7-diazaspiro[3.4]octane;2-methyl-6-oxa-2-azaspiro[3.4]octane |
| SMILES | CN1CC2(CCOC2)C1.CN1CCC2(C1)CN(C)C2 |
| InChI | InChI=1S/C8H16N2.C7H13NO/c1-9-4-3-8(5-9)6-10(2)7-8;1-8-4-7(5-8)2-3-9-6-7/h3-7H2,1-2H3;2-6H2,1H3 |
| InChIKey | XGPUAMFAVMQKPF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,7-dimethyl-2,7-diazaspiro[3.4]octane;2-methyl-6-oxa-2-azaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethyl-2,7-diazaspiro[3.4]octane;2-methyl-6-oxa-2-azaspiro[3.4]octane?
The IUPAC name of 2,7-dimethyl-2,7-diazaspiro[3.4]octane;2-methyl-6-oxa-2-azaspiro[3.4]octane (CID 166170976) is 2,7-dimethyl-2,7-diazaspiro[3.4]octane;2-methyl-6-oxa-2-azaspiro[3.4]octane.
What is the SMILES notation for 2,7-dimethyl-2,7-diazaspiro[3.4]octane;2-methyl-6-oxa-2-azaspiro[3.4]octane?
The canonical SMILES for 2,7-dimethyl-2,7-diazaspiro[3.4]octane;2-methyl-6-oxa-2-azaspiro[3.4]octane is CN1CC2(CCOC2)C1.CN1CCC2(C1)CN(C)C2.
What is the InChIKey of 2,7-dimethyl-2,7-diazaspiro[3.4]octane;2-methyl-6-oxa-2-azaspiro[3.4]octane?
The InChIKey is XGPUAMFAVMQKPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.C7H13NO/c1-9-4-3-8(5-9)6-10(2)7-8;1-8-4-7(5-8)2-3-9-6-7/h3-7H2,1-2H3;2-6H2,1H3.
What are the key properties of 2,7-dimethyl-2,7-diazaspiro[3.4]octane;2-methyl-6-oxa-2-azaspiro[3.4]octane?
2,7-dimethyl-2,7-diazaspiro[3.4]octane;2-methyl-6-oxa-2-azaspiro[3.4]octane has a molecular weight of 267.42 g/mol, XLogP of 0.59, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethyl-2,7-diazaspiro[3.4]octane;2-methyl-6-oxa-2-azaspiro[3.4]octane is sourced from PubChem (CID 166170976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).