About 2-butan-2-yl-8-methyl-2,8-diazaspiro[4.5]decane
2-butan-2-yl-8-methyl-2,8-diazaspiro[4.5]decane (PubChem CID 170581950) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is 2-butan-2-yl-8-methyl-2,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 2-butan-2-yl-8-methyl-2,8-diazaspiro[4.5]decane |
| PubChem CID | 170581950 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 2-butan-2-yl-8-methyl-2,8-diazaspiro[4.5]decane |
| SMILES | CCC(C)N1CCC2(CCN(C)CC2)C1 |
| InChI | InChI=1S/C13H26N2/c1-4-12(2)15-10-7-13(11-15)5-8-14(3)9-6-13/h12H,4-11H2,1-3H3 |
| InChIKey | TUHJPGNBXDDEOM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butan-2-yl-8-methyl-2,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-8-methyl-2,8-diazaspiro[4.5]decane?
The IUPAC name of 2-butan-2-yl-8-methyl-2,8-diazaspiro[4.5]decane (CID 170581950) is 2-butan-2-yl-8-methyl-2,8-diazaspiro[4.5]decane.
What is the SMILES notation for 2-butan-2-yl-8-methyl-2,8-diazaspiro[4.5]decane?
The canonical SMILES for 2-butan-2-yl-8-methyl-2,8-diazaspiro[4.5]decane is CCC(C)N1CCC2(CCN(C)CC2)C1.
What is the InChIKey of 2-butan-2-yl-8-methyl-2,8-diazaspiro[4.5]decane?
The InChIKey is TUHJPGNBXDDEOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2/c1-4-12(2)15-10-7-13(11-15)5-8-14(3)9-6-13/h12H,4-11H2,1-3H3.
What are the key properties of 2-butan-2-yl-8-methyl-2,8-diazaspiro[4.5]decane?
2-butan-2-yl-8-methyl-2,8-diazaspiro[4.5]decane has a molecular weight of 210.36 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-8-methyl-2,8-diazaspiro[4.5]decane is sourced from PubChem (CID 170581950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).