C20H37N3 — CID 167417400
7-propan-2-yl-2-[(2-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)methyl]-2,7-diazaspiro[3.4]octane (PubChem CID 167417400) has the molecular formula C20H37N3 and a molecular weight of 319.54 g/mol. Its IUPAC name is 7-propan-2-yl-2-[(2-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)methyl]-2,7-diazaspiro[3.4]octane.
| Compound Name | 7-propan-2-yl-2-[(2-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)methyl]-2,7-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 167417400 |
| Molecular Formula | C20H37N3 |
| Molecular Weight | 319.54 g/mol |
| Exact Mass | 319.30 |
| IUPAC Name | 7-propan-2-yl-2-[(2-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)methyl]-2,7-diazaspiro[3.4]octane |
| SMILES | CC(C)N1CC2CC(CN3CC4(CCN(C(C)C)C4)C3)CC2C1 |
| InChI | InChI=1S/C20H37N3/c1-15(2)22-6-5-20(14-22)12-21(13-20)9-17-7-18-10-23(16(3)4)11-19(18)8-17/h15-19H,5-14H2,1-4H3 |
| InChIKey | MCAMYFUJVHDAKR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |