C13H24N4S — CID 165344788
3,11-dimethyl-3,7,11,14-tetrazadispiro[5.1.58.26]pentadecane-15-thione (PubChem CID 165344788) has the molecular formula C13H24N4S and a molecular weight of 268.43 g/mol. Its IUPAC name is 3,11-dimethyl-3,7,11,14-tetrazadispiro[5.1.58.26]pentadecane-15-thione.
| Compound Name | 3,11-dimethyl-3,7,11,14-tetrazadispiro[5.1.58.26]pentadecane-15-thione |
|---|---|
| PubChem CID | 165344788 |
| Molecular Formula | C13H24N4S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 3,11-dimethyl-3,7,11,14-tetrazadispiro[5.1.58.26]pentadecane-15-thione |
| SMILES | CN1CCC2(CC1)NC(=S)C1(CCN(C)CC1)N2 |
| InChI | InChI=1S/C13H24N4S/c1-16-7-3-12(4-8-16)11(18)14-13(15-12)5-9-17(2)10-6-13/h15H,3-10H2,1-2H3,(H,14,18) |
| InChIKey | IHMMYTDFJWLJNU-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|