About 2-iodo-9-methyl-2,6,9-triazaspiro[4.5]decan-1-one
2-iodo-9-methyl-2,6,9-triazaspiro[4.5]decan-1-one (PubChem CID 170035585) has the molecular formula C8H14IN3O
and a molecular weight of 295.12 g/mol. Its IUPAC name is 2-iodo-9-methyl-2,6,9-triazaspiro[4.5]decan-1-one.
Molecular Properties
| Compound Name | 2-iodo-9-methyl-2,6,9-triazaspiro[4.5]decan-1-one |
| PubChem CID | 170035585 |
| Molecular Formula | C8H14IN3O |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 2-iodo-9-methyl-2,6,9-triazaspiro[4.5]decan-1-one |
| SMILES | CN1CCNC2(CCN(I)C2=O)C1 |
| InChI | InChI=1S/C8H14IN3O/c1-11-5-3-10-8(6-11)2-4-12(9)7(8)13/h10H,2-6H2,1H3 |
| InChIKey | LIHWDAYRQRQNJR-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-9-methyl-2,6,9-triazaspiro[4.5]decan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-9-methyl-2,6,9-triazaspiro[4.5]decan-1-one?
The IUPAC name of 2-iodo-9-methyl-2,6,9-triazaspiro[4.5]decan-1-one (CID 170035585) is 2-iodo-9-methyl-2,6,9-triazaspiro[4.5]decan-1-one.
What is the SMILES notation for 2-iodo-9-methyl-2,6,9-triazaspiro[4.5]decan-1-one?
The canonical SMILES for 2-iodo-9-methyl-2,6,9-triazaspiro[4.5]decan-1-one is CN1CCNC2(CCN(I)C2=O)C1.
What is the InChIKey of 2-iodo-9-methyl-2,6,9-triazaspiro[4.5]decan-1-one?
The InChIKey is LIHWDAYRQRQNJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14IN3O/c1-11-5-3-10-8(6-11)2-4-12(9)7(8)13/h10H,2-6H2,1H3.
What are the key properties of 2-iodo-9-methyl-2,6,9-triazaspiro[4.5]decan-1-one?
2-iodo-9-methyl-2,6,9-triazaspiro[4.5]decan-1-one has a molecular weight of 295.12 g/mol, XLogP of -0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-9-methyl-2,6,9-triazaspiro[4.5]decan-1-one is sourced from PubChem (CID 170035585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).