C11H18IN3O2 — CID 170035617
2-iodo-9-(2-methylpropanoyl)-2,6,9-triazaspiro[4.5]decan-1-one (PubChem CID 170035617) has the molecular formula C11H18IN3O2 and a molecular weight of 351.19 g/mol. Its IUPAC name is 2-iodo-9-(2-methylpropanoyl)-2,6,9-triazaspiro[4.5]decan-1-one.
| Compound Name | 2-iodo-9-(2-methylpropanoyl)-2,6,9-triazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 170035617 |
| Molecular Formula | C11H18IN3O2 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-iodo-9-(2-methylpropanoyl)-2,6,9-triazaspiro[4.5]decan-1-one |
| SMILES | CC(C)C(=O)N1CCNC2(CCN(I)C2=O)C1 |
| InChI | InChI=1S/C11H18IN3O2/c1-8(2)9(16)14-6-4-13-11(7-14)3-5-15(12)10(11)17/h8,13H,3-7H2,1-2H3 |
| InChIKey | MQJGQOVFFJZOEL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|