C10H19N3O — CID 82398724
2,8-dimethyl-1,4,8-triazaspiro[5.5]undecan-3-one (PubChem CID 82398724) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 2,8-dimethyl-1,4,8-triazaspiro[5.5]undecan-3-one.
| Compound Name | 2,8-dimethyl-1,4,8-triazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 82398724 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2,8-dimethyl-1,4,8-triazaspiro[5.5]undecan-3-one |
| SMILES | CC1NC2(CCCN(C)C2)CNC1=O |
| InChI | InChI=1S/C10H19N3O/c1-8-9(14)11-6-10(12-8)4-3-5-13(2)7-10/h8,12H,3-7H2,1-2H3,(H,11,14) |
| InChIKey | JMZHLJWFDKJXAO-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |