C14H16F3N — CID 175706595
6-[4-(trifluoromethyl)phenyl]-2-azaspiro[3.4]octane (PubChem CID 175706595) has the molecular formula C14H16F3N and a molecular weight of 255.28 g/mol. Its IUPAC name is 6-[4-(trifluoromethyl)phenyl]-2-azaspiro[3.4]octane.
| Compound Name | 6-[4-(trifluoromethyl)phenyl]-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 175706595 |
| Molecular Formula | C14H16F3N |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 6-[4-(trifluoromethyl)phenyl]-2-azaspiro[3.4]octane |
| SMILES | FC(F)(F)c1ccc(C2CCC3(CNC3)C2)cc1 |
| InChI | InChI=1S/C14H16F3N/c15-14(16,17)12-3-1-10(2-4-12)11-5-6-13(7-11)8-18-9-13/h1-4,11,18H,5-9H2 |
| InChIKey | HVQAYIYRYXSSOD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |