C19H24F3NO2 — CID 156864561
tert-butyl 6-[4-(trifluoromethyl)phenyl]-2-azaspiro[3.4]octane-2-carboxylate (PubChem CID 156864561) has the molecular formula C19H24F3NO2 and a molecular weight of 355.40 g/mol. Its IUPAC name is tert-butyl 6-[4-(trifluoromethyl)phenyl]-2-azaspiro[3.4]octane-2-carboxylate.
| Compound Name | tert-butyl 6-[4-(trifluoromethyl)phenyl]-2-azaspiro[3.4]octane-2-carboxylate |
|---|---|
| PubChem CID | 156864561 |
| Molecular Formula | C19H24F3NO2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | tert-butyl 6-[4-(trifluoromethyl)phenyl]-2-azaspiro[3.4]octane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCC(c3ccc(C(F)(F)F)cc3)C2)C1 |
| InChI | InChI=1S/C19H24F3NO2/c1-17(2,3)25-16(24)23-11-18(12-23)9-8-14(10-18)13-4-6-15(7-5-13)19(20,21)22/h4-7,14H,8-12H2,1-3H3 |
| InChIKey | UBHZOIOAZPDAFV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |