About 3,8-dimethylspiro[4.4]nonane;ethane
3,8-dimethylspiro[4.4]nonane;ethane (PubChem CID 178108265) has the molecular formula C15H32
and a molecular weight of 212.42 g/mol. Its IUPAC name is 3,8-dimethylspiro[4.4]nonane;ethane.
Molecular Properties
| Compound Name | 3,8-dimethylspiro[4.4]nonane;ethane |
| PubChem CID | 178108265 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | 3,8-dimethylspiro[4.4]nonane;ethane |
| SMILES | CC.CC.CC1CCC2(CCC(C)C2)C1 |
| InChI | InChI=1S/C11H20.2C2H6/c1-9-3-5-11(7-9)6-4-10(2)8-11;2*1-2/h9-10H,3-8H2,1-2H3;2*1-2H3 |
| InChIKey | RIBZNAOCHZNFOI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,8-dimethylspiro[4.4]nonane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dimethylspiro[4.4]nonane;ethane?
The IUPAC name of 3,8-dimethylspiro[4.4]nonane;ethane (CID 178108265) is 3,8-dimethylspiro[4.4]nonane;ethane.
What is the SMILES notation for 3,8-dimethylspiro[4.4]nonane;ethane?
The canonical SMILES for 3,8-dimethylspiro[4.4]nonane;ethane is CC.CC.CC1CCC2(CCC(C)C2)C1.
What is the InChIKey of 3,8-dimethylspiro[4.4]nonane;ethane?
The InChIKey is RIBZNAOCHZNFOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20.2C2H6/c1-9-3-5-11(7-9)6-4-10(2)8-11;2*1-2/h9-10H,3-8H2,1-2H3;2*1-2H3.
What are the key properties of 3,8-dimethylspiro[4.4]nonane;ethane?
3,8-dimethylspiro[4.4]nonane;ethane has a molecular weight of 212.42 g/mol, XLogP of 5.67, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dimethylspiro[4.4]nonane;ethane is sourced from PubChem (CID 178108265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).