C12H23NO2 — CID 122680753
1-methoxy-2,2,8,8-tetramethylazocan-5-one (PubChem CID 122680753) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-methoxy-2,2,8,8-tetramethylazocan-5-one.
| Compound Name | 1-methoxy-2,2,8,8-tetramethylazocan-5-one |
|---|---|
| PubChem CID | 122680753 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 1-methoxy-2,2,8,8-tetramethylazocan-5-one |
| SMILES | CON1C(C)(C)CCC(=O)CCC1(C)C |
| InChI | InChI=1S/C12H23NO2/c1-11(2)8-6-10(14)7-9-12(3,4)13(11)15-5/h6-9H2,1-5H3 |
| InChIKey | QLNHPTZRQCTOIW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |