C21H41N3O2 — CID 126746115
12-methoxy-2,2,4,4,11,11,13,13-octamethyl-3,7,12-triazaspiro[5.9]pentadecan-8-one (PubChem CID 126746115) has the molecular formula C21H41N3O2 and a molecular weight of 367.58 g/mol. Its IUPAC name is 12-methoxy-2,2,4,4,11,11,13,13-octamethyl-3,7,12-triazaspiro[5.9]pentadecan-8-one.
| Compound Name | 12-methoxy-2,2,4,4,11,11,13,13-octamethyl-3,7,12-triazaspiro[5.9]pentadecan-8-one |
|---|---|
| PubChem CID | 126746115 |
| Molecular Formula | C21H41N3O2 |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.32 |
| IUPAC Name | 12-methoxy-2,2,4,4,11,11,13,13-octamethyl-3,7,12-triazaspiro[5.9]pentadecan-8-one |
| SMILES | CON1C(C)(C)CCC(=O)NC2(CCC1(C)C)CC(C)(C)NC(C)(C)C2 |
| InChI | InChI=1S/C21H41N3O2/c1-17(2)14-21(15-18(3,4)23-17)13-12-20(7,8)24(26-9)19(5,6)11-10-16(25)22-21/h23H,10-15H2,1-9H3,(H,22,25) |
| InChIKey | HSYJVBVCYAHXTE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |