C19H32O2 — CID 58571239
(6Z)-11-acetyl-2-ethyl-2,11-dimethylcyclotridec-6-en-1-one (PubChem CID 58571239) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is (6Z)-11-acetyl-2-ethyl-2,11-dimethylcyclotridec-6-en-1-one.
| Compound Name | (6Z)-11-acetyl-2-ethyl-2,11-dimethylcyclotridec-6-en-1-one |
|---|---|
| PubChem CID | 58571239 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | (6Z)-11-acetyl-2-ethyl-2,11-dimethylcyclotridec-6-en-1-one |
| SMILES | CCC1(C)CCC/C=C\CCCC(C)(C(C)=O)CCC1=O |
| InChI | InChI=1S/C19H32O2/c1-5-18(3)13-10-8-6-7-9-11-14-19(4,16(2)20)15-12-17(18)21/h6-7H,5,8-15H2,1-4H3/b7-6- |
| InChIKey | AWWGLABATQFFEK-SREVYHEPSA-N |
| XLogP | 5.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|