C19H31NO3S2 — CID 148533327
(3Z,8R,12R)-12-(2-aminoacetyl)-8,12-dimethyl-8-(3-oxobutyl)-1,6-dithiacyclotridec-3-en-9-one (PubChem CID 148533327) has the molecular formula C19H31NO3S2 and a molecular weight of 385.60 g/mol. Its IUPAC name is (3Z,8R,12R)-12-(2-aminoacetyl)-8,12-dimethyl-8-(3-oxobutyl)-1,6-dithiacyclotridec-3-en-9-one.
| Compound Name | (3Z,8R,12R)-12-(2-aminoacetyl)-8,12-dimethyl-8-(3-oxobutyl)-1,6-dithiacyclotridec-3-en-9-one |
|---|---|
| PubChem CID | 148533327 |
| Molecular Formula | C19H31NO3S2 |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (3Z,8R,12R)-12-(2-aminoacetyl)-8,12-dimethyl-8-(3-oxobutyl)-1,6-dithiacyclotridec-3-en-9-one |
| SMILES | CC(=O)CC[C@@]1(C)CSC/C=C\CSC[C@@](C)(C(=O)CN)CCC1=O |
| InChI | InChI=1S/C19H31NO3S2/c1-15(21)6-8-18(2)13-24-10-4-5-11-25-14-19(3,17(23)12-20)9-7-16(18)22/h4-5H,6-14,20H2,1-3H3/b5-4-/t18-,19-/m0/s1 |
| InChIKey | MQSDVDJSNLYZGY-DHJFXDNESA-N |
| XLogP | 3.28 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|