C10H15ClO — CID 11106076
(1S,5R)-5-(3-chloropropyl)bicyclo[3.2.0]heptan-6-one (PubChem CID 11106076) has the molecular formula C10H15ClO and a molecular weight of 186.68 g/mol. Its IUPAC name is (1S,5R)-5-(3-chloropropyl)bicyclo[3.2.0]heptan-6-one.
| Compound Name | (1S,5R)-5-(3-chloropropyl)bicyclo[3.2.0]heptan-6-one |
|---|---|
| PubChem CID | 11106076 |
| Molecular Formula | C10H15ClO |
| Molecular Weight | 186.68 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | (1S,5R)-5-(3-chloropropyl)bicyclo[3.2.0]heptan-6-one |
| SMILES | O=C1C[C@@H]2CCC[C@]12CCCCl |
| InChI | InChI=1S/C10H15ClO/c11-6-2-5-10-4-1-3-8(10)7-9(10)12/h8H,1-7H2/t8-,10+/m0/s1 |
| InChIKey | FFHYPHQTEFLFKZ-WCBMZHEXSA-N |
| XLogP | 2.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.68 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|