C11H17ClO2 — CID 15828402
(3aS,7aR)-7a-(3-chloropropyl)-3,3a,4,5,6,7-hexahydro-1-benzofuran-2-one (PubChem CID 15828402) has the molecular formula C11H17ClO2 and a molecular weight of 216.71 g/mol. Its IUPAC name is (3aS,7aR)-7a-(3-chloropropyl)-3,3a,4,5,6,7-hexahydro-1-benzofuran-2-one.
| Compound Name | (3aS,7aR)-7a-(3-chloropropyl)-3,3a,4,5,6,7-hexahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 15828402 |
| Molecular Formula | C11H17ClO2 |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | (3aS,7aR)-7a-(3-chloropropyl)-3,3a,4,5,6,7-hexahydro-1-benzofuran-2-one |
| SMILES | O=C1C[C@@H]2CCCC[C@]2(CCCCl)O1 |
| InChI | InChI=1S/C11H17ClO2/c12-7-3-6-11-5-2-1-4-9(11)8-10(13)14-11/h9H,1-8H2/t9-,11+/m0/s1 |
| InChIKey | PWYFHWZOBGOJFW-GXSJLCMTSA-N |
| XLogP | 2.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|