C16H23NO3S — CID 142827931
3-(2-cyclohexyl-4,6-dioxooxan-2-yl)-N-ethenylpropanethioamide (PubChem CID 142827931) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is 3-(2-cyclohexyl-4,6-dioxooxan-2-yl)-N-ethenylpropanethioamide.
| Compound Name | 3-(2-cyclohexyl-4,6-dioxooxan-2-yl)-N-ethenylpropanethioamide |
|---|---|
| PubChem CID | 142827931 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 3-(2-cyclohexyl-4,6-dioxooxan-2-yl)-N-ethenylpropanethioamide |
| SMILES | C=CNC(=S)CCC1(C2CCCCC2)CC(=O)CC(=O)O1 |
| InChI | InChI=1S/C16H23NO3S/c1-2-17-14(21)8-9-16(12-6-4-3-5-7-12)11-13(18)10-15(19)20-16/h2,12H,1,3-11H2,(H,17,21) |
| InChIKey | CFHUHQCOQMZVPJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|