C16H19NO3 — CID 132509501
(3aR,7aS)-N-benzyl-2-oxo-3,3a,4,5,6,7-hexahydro-1-benzofuran-7a-carboxamide (PubChem CID 132509501) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is (3aR,7aS)-N-benzyl-2-oxo-3,3a,4,5,6,7-hexahydro-1-benzofuran-7a-carboxamide.
| Compound Name | (3aR,7aS)-N-benzyl-2-oxo-3,3a,4,5,6,7-hexahydro-1-benzofuran-7a-carboxamide |
|---|---|
| PubChem CID | 132509501 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (3aR,7aS)-N-benzyl-2-oxo-3,3a,4,5,6,7-hexahydro-1-benzofuran-7a-carboxamide |
| SMILES | O=C1C[C@H]2CCCC[C@]2(C(=O)NCc2ccccc2)O1 |
| InChI | InChI=1S/C16H19NO3/c18-14-10-13-8-4-5-9-16(13,20-14)15(19)17-11-12-6-2-1-3-7-12/h1-3,6-7,13H,4-5,8-11H2,(H,17,19)/t13-,16+/m1/s1 |
| InChIKey | IRSUVVNPQNMEHS-CJNGLKHVSA-N |
| XLogP | 2.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |