C17H21NO3 — CID 3077984
N-benzyl-2-oxo-1-oxaspiro[4.5]decane-4-carboxamide (PubChem CID 3077984) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-benzyl-2-oxo-1-oxaspiro[4.5]decane-4-carboxamide.
| Compound Name | N-benzyl-2-oxo-1-oxaspiro[4.5]decane-4-carboxamide |
|---|---|
| PubChem CID | 3077984 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N-benzyl-2-oxo-1-oxaspiro[4.5]decane-4-carboxamide |
| SMILES | O=C1CC(C(=O)NCc2ccccc2)C2(CCCCC2)O1 |
| InChI | InChI=1S/C17H21NO3/c19-15-11-14(17(21-15)9-5-2-6-10-17)16(20)18-12-13-7-3-1-4-8-13/h1,3-4,7-8,14H,2,5-6,9-12H2,(H,18,20) |
| InChIKey | GEOUDRDQCAMJFE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |