C17H20FNO3 — CID 56730546
N-[(2-fluorophenyl)methyl]-2-oxo-1-oxaspiro[4.5]decane-4-carboxamide (PubChem CID 56730546) has the molecular formula C17H20FNO3 and a molecular weight of 305.35 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-2-oxo-1-oxaspiro[4.5]decane-4-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-2-oxo-1-oxaspiro[4.5]decane-4-carboxamide |
|---|---|
| PubChem CID | 56730546 |
| Molecular Formula | C17H20FNO3 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-2-oxo-1-oxaspiro[4.5]decane-4-carboxamide |
| SMILES | O=C1CC(C(=O)NCc2ccccc2F)C2(CCCCC2)O1 |
| InChI | InChI=1S/C17H20FNO3/c18-14-7-3-2-6-12(14)11-19-16(21)13-10-15(20)22-17(13)8-4-1-5-9-17/h2-3,6-7,13H,1,4-5,8-11H2,(H,19,21) |
| InChIKey | KHBKKNFEZYICFF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |