C21H26FNO4 — CID 125157021
(4R)-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-oxo-1-oxaspiro[4.4]nonane-4-carboxamide (PubChem CID 125157021) has the molecular formula C21H26FNO4 and a molecular weight of 375.44 g/mol. Its IUPAC name is (4R)-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-oxo-1-oxaspiro[4.4]nonane-4-carboxamide.
| Compound Name | (4R)-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-oxo-1-oxaspiro[4.4]nonane-4-carboxamide |
|---|---|
| PubChem CID | 125157021 |
| Molecular Formula | C21H26FNO4 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (4R)-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-oxo-1-oxaspiro[4.4]nonane-4-carboxamide |
| SMILES | O=C1C[C@@H](C(=O)NCC2(c3cccc(F)c3)CCOCC2)C2(CCCC2)O1 |
| InChI | InChI=1S/C21H26FNO4/c22-16-5-3-4-15(12-16)20(8-10-26-11-9-20)14-23-19(25)17-13-18(24)27-21(17)6-1-2-7-21/h3-5,12,17H,1-2,6-11,13-14H2,(H,23,25)/t17-/m0/s1 |
| InChIKey | ABSIRKLBHIWTJA-KRWDZBQOSA-N |
| XLogP | 2.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |