C17H22ClFN2O2 — CID 154906936
N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide;hydrochloride (PubChem CID 154906936) has the molecular formula C17H22ClFN2O2 and a molecular weight of 340.83 g/mol. Its IUPAC name is N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide;hydrochloride.
| Compound Name | N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 154906936 |
| Molecular Formula | C17H22ClFN2O2 |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCC1(c2cccc(F)c2)CCOCC1)C1C=CCN1 |
| InChI | InChI=1S/C17H21FN2O2.ClH/c18-14-4-1-3-13(11-14)17(6-9-22-10-7-17)12-20-16(21)15-5-2-8-19-15;/h1-5,11,15,19H,6-10,12H2,(H,20,21);1H |
| InChIKey | KCXAHXBHTSDQEG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|