C21H28FNO2 — CID 86952712
N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-(4-methylcyclohexylidene)acetamide (PubChem CID 86952712) has the molecular formula C21H28FNO2 and a molecular weight of 345.46 g/mol. Its IUPAC name is N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-(4-methylcyclohexylidene)acetamide.
| Compound Name | N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-(4-methylcyclohexylidene)acetamide |
|---|---|
| PubChem CID | 86952712 |
| Molecular Formula | C21H28FNO2 |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-(4-methylcyclohexylidene)acetamide |
| SMILES | CC1CCC(=CC(=O)NCC2(c3cccc(F)c3)CCOCC2)CC1 |
| InChI | InChI=1S/C21H28FNO2/c1-16-5-7-17(8-6-16)13-20(24)23-15-21(9-11-25-12-10-21)18-3-2-4-19(22)14-18/h2-4,13-14,16H,5-12,15H2,1H3,(H,23,24)/b17-13- |
| InChIKey | DBXRKRICIQNURL-LGMDPLHJSA-N |
| XLogP | 4.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|