C17H19FN2O2 — CID 132968647
N-[[1-(3-fluorophenyl)cyclohexyl]methyl]-1,2-oxazole-3-carboxamide (PubChem CID 132968647) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is N-[[1-(3-fluorophenyl)cyclohexyl]methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-[[1-(3-fluorophenyl)cyclohexyl]methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 132968647 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-[[1-(3-fluorophenyl)cyclohexyl]methyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCC1(c2cccc(F)c2)CCCCC1)c1ccon1 |
| InChI | InChI=1S/C17H19FN2O2/c18-14-6-4-5-13(11-14)17(8-2-1-3-9-17)12-19-16(21)15-7-10-22-20-15/h4-7,10-11H,1-3,8-9,12H2,(H,19,21) |
| InChIKey | KIXLGAMOTNAVDR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |