C19H21FN2OS — CID 91797143
N-[[1-(3-fluorophenyl)cyclopentyl]methyl]-2-pyridin-4-ylsulfanylacetamide (PubChem CID 91797143) has the molecular formula C19H21FN2OS and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[[1-(3-fluorophenyl)cyclopentyl]methyl]-2-pyridin-4-ylsulfanylacetamide.
| Compound Name | N-[[1-(3-fluorophenyl)cyclopentyl]methyl]-2-pyridin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 91797143 |
| Molecular Formula | C19H21FN2OS |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-[[1-(3-fluorophenyl)cyclopentyl]methyl]-2-pyridin-4-ylsulfanylacetamide |
| SMILES | O=C(CSc1ccncc1)NCC1(c2cccc(F)c2)CCCC1 |
| InChI | InChI=1S/C19H21FN2OS/c20-16-5-3-4-15(12-16)19(8-1-2-9-19)14-22-18(23)13-24-17-6-10-21-11-7-17/h3-7,10-12H,1-2,8-9,13-14H2,(H,22,23) |
| InChIKey | GWEVNSIDPCBPNG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |