C13H20 — CID 10773625
1-prop-2-enyl-1,2,3,4,5,6,7,8-octahydronaphthalene (PubChem CID 10773625) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 1-prop-2-enyl-1,2,3,4,5,6,7,8-octahydronaphthalene.
| Compound Name | 1-prop-2-enyl-1,2,3,4,5,6,7,8-octahydronaphthalene |
|---|---|
| PubChem CID | 10773625 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 1-prop-2-enyl-1,2,3,4,5,6,7,8-octahydronaphthalene |
| SMILES | C=CCC1CCCC2=C1CCCC2 |
| InChI | InChI=1S/C13H20/c1-2-6-11-8-5-9-12-7-3-4-10-13(11)12/h2,11H,1,3-10H2 |
| InChIKey | UIHHPOPJWZMLSN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|