C21H34O3 — CID 165014812
1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one (PubChem CID 165014812) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one.
| Compound Name | 1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one |
|---|---|
| PubChem CID | 165014812 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one |
| SMILES | C=CCC1CCCCC1=O.C=CCOC1(OCC=C)CCCCC1 |
| InChI | InChI=1S/C12H20O2.C9H14O/c1-3-10-13-12(14-11-4-2)8-6-5-7-9-12;1-2-5-8-6-3-4-7-9(8)10/h3-4H,1-2,5-11H2;2,8H,1,3-7H2 |
| InChIKey | KGGVTONYPNHGNZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|