About 1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one
1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one (PubChem CID 165014812) has the molecular formula C21H34O3
and a molecular weight of 334.50 g/mol. Its IUPAC name is 1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one.
Molecular Properties
| Compound Name | 1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one |
| PubChem CID | 165014812 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one |
| SMILES | C=CCC1CCCCC1=O.C=CCOC1(OCC=C)CCCCC1 |
| InChI | InChI=1S/C12H20O2.C9H14O/c1-3-10-13-12(14-11-4-2)8-6-5-7-9-12;1-2-5-8-6-3-4-7-9(8)10/h3-4H,1-2,5-11H2;2,8H,1,3-7H2 |
| InChIKey | KGGVTONYPNHGNZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one?
The IUPAC name of 1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one (CID 165014812) is 1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one.
What is the SMILES notation for 1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one?
The canonical SMILES for 1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one is C=CCC1CCCCC1=O.C=CCOC1(OCC=C)CCCCC1.
What is the InChIKey of 1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one?
The InChIKey is KGGVTONYPNHGNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2.C9H14O/c1-3-10-13-12(14-11-4-2)8-6-5-7-9-12;1-2-5-8-6-3-4-7-9(8)10/h3-4H,1-2,5-11H2;2,8H,1,3-7H2.
What are the key properties of 1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one?
1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one has a molecular weight of 334.50 g/mol, XLogP of 5.37, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-bis(prop-2-enoxy)cyclohexane;2-prop-2-enylcyclohexan-1-one is sourced from PubChem (CID 165014812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).