C13H21N — CID 12966046
(1S,9R,13R)-tricyclo[7.3.1.02,7]tridec-2(7)-en-13-amine (PubChem CID 12966046) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (1S,9R,13R)-tricyclo[7.3.1.02,7]tridec-2(7)-en-13-amine.
| Compound Name | (1S,9R,13R)-tricyclo[7.3.1.02,7]tridec-2(7)-en-13-amine |
|---|---|
| PubChem CID | 12966046 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (1S,9R,13R)-tricyclo[7.3.1.02,7]tridec-2(7)-en-13-amine |
| SMILES | N[C@@H]1[C@@H]2CCC[C@H]1C1=C(CCCC1)C2 |
| InChI | InChI=1S/C13H21N/c14-13-10-5-3-7-12(13)11-6-2-1-4-9(11)8-10/h10,12-13H,1-8,14H2/t10-,12+,13-/m1/s1 |
| InChIKey | RNIDTNZHNRWZFL-KGYLQXTDSA-N |
| XLogP | 3.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|