C20H24N2O2 — CID 6954338
1-(4-nitrophenyl)-N-[(1S,9S,13S)-13-tricyclo[7.3.1.02,7]tridec-2(7)-enyl]methanimine (PubChem CID 6954338) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-N-[(1S,9S,13S)-13-tricyclo[7.3.1.02,7]tridec-2(7)-enyl]methanimine.
| Compound Name | 1-(4-nitrophenyl)-N-[(1S,9S,13S)-13-tricyclo[7.3.1.02,7]tridec-2(7)-enyl]methanimine |
|---|---|
| PubChem CID | 6954338 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1-(4-nitrophenyl)-N-[(1S,9S,13S)-13-tricyclo[7.3.1.02,7]tridec-2(7)-enyl]methanimine |
| SMILES | O=[N+]([O-])c1ccc(/C=N/[C@H]2[C@H]3CCC[C@H]2C2=C(CCCC2)C3)cc1 |
| InChI | InChI=1S/C20H24N2O2/c23-22(24)17-10-8-14(9-11-17)13-21-20-16-5-3-7-19(20)18-6-2-1-4-15(18)12-16/h8-11,13,16,19-20H,1-7,12H2/b21-13+/t16-,19-,20-/m0/s1 |
| InChIKey | AGNSXOBSVWJNTP-VVCFHKFESA-N |
| XLogP | 5.07 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|