C23H40P2 — CID 155135812
dicyclohexyl-[(1R,2S)-2-[(1R)-1-phosphanylethyl]-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]phosphane (PubChem CID 155135812) has the molecular formula C23H40P2 and a molecular weight of 378.52 g/mol. Its IUPAC name is dicyclohexyl-[(1R,2S)-2-[(1R)-1-phosphanylethyl]-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]phosphane.
| Compound Name | dicyclohexyl-[(1R,2S)-2-[(1R)-1-phosphanylethyl]-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]phosphane |
|---|---|
| PubChem CID | 155135812 |
| Molecular Formula | C23H40P2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | dicyclohexyl-[(1R,2S)-2-[(1R)-1-phosphanylethyl]-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]phosphane |
| SMILES | C[C@@H](P)[C@@H]1CC2=C(CCCC2)[C@@H]1P(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C23H40P2/c1-17(24)22-16-18-10-8-9-15-21(18)23(22)25(19-11-4-2-5-12-19)20-13-6-3-7-14-20/h17,19-20,22-23H,2-16,24H2,1H3/t17-,22+,23+/m1/s1 |
| InChIKey | DGVYTYNTTDCHTC-VSDWSMLSSA-N |
| XLogP | 7.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|