About bis(2-methylpropyl)alumane;tricyclohexylphosphane
bis(2-methylpropyl)alumane;tricyclohexylphosphane (PubChem CID 159231052) has the molecular formula C26H52AlP
and a molecular weight of 422.66 g/mol. Its IUPAC name is bis(2-methylpropyl)alumane;tricyclohexylphosphane.
Molecular Properties
| Compound Name | bis(2-methylpropyl)alumane;tricyclohexylphosphane |
| PubChem CID | 159231052 |
| Molecular Formula | C26H52AlP |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.36 |
| IUPAC Name | bis(2-methylpropyl)alumane;tricyclohexylphosphane |
| SMILES | C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.CC(C)C[AlH]CC(C)C |
| InChI | InChI=1S/C18H33P.2C4H9.Al.H/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2*1-4(2)3;;/h16-18H,1-15H2;2*4H,1H2,2-3H3;; |
| InChIKey | FALNIKPXTYBLCV-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylpropyl)alumane;tricyclohexylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylpropyl)alumane;tricyclohexylphosphane?
The IUPAC name of bis(2-methylpropyl)alumane;tricyclohexylphosphane (CID 159231052) is bis(2-methylpropyl)alumane;tricyclohexylphosphane.
What is the SMILES notation for bis(2-methylpropyl)alumane;tricyclohexylphosphane?
The canonical SMILES for bis(2-methylpropyl)alumane;tricyclohexylphosphane is C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.CC(C)C[AlH]CC(C)C.
What is the InChIKey of bis(2-methylpropyl)alumane;tricyclohexylphosphane?
The InChIKey is FALNIKPXTYBLCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33P.2C4H9.Al.H/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2*1-4(2)3;;/h16-18H,1-15H2;2*4H,1H2,2-3H3;;.
What are the key properties of bis(2-methylpropyl)alumane;tricyclohexylphosphane?
bis(2-methylpropyl)alumane;tricyclohexylphosphane has a molecular weight of 422.66 g/mol, XLogP of 9.04, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpropyl)alumane;tricyclohexylphosphane is sourced from PubChem (CID 159231052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).