C13H22S — CID 172855637
2-tert-butyl-3,4,5,6,7,8-hexahydro-2H-thiochromene (PubChem CID 172855637) has the molecular formula C13H22S and a molecular weight of 210.39 g/mol. Its IUPAC name is 2-tert-butyl-3,4,5,6,7,8-hexahydro-2H-thiochromene.
| Compound Name | 2-tert-butyl-3,4,5,6,7,8-hexahydro-2H-thiochromene |
|---|---|
| PubChem CID | 172855637 |
| Molecular Formula | C13H22S |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-tert-butyl-3,4,5,6,7,8-hexahydro-2H-thiochromene |
| SMILES | CC(C)(C)C1CCC2=C(CCCC2)S1 |
| InChI | InChI=1S/C13H22S/c1-13(2,3)12-9-8-10-6-4-5-7-11(10)14-12/h12H,4-9H2,1-3H3 |
| InChIKey | YQZBQDHTRSNIRV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |