C32H39NSi — CID 141005417
N-[dimethyl-(2-methyl-1H-inden-1-yl)silyl]-2-methylpropan-2-amine;[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene (PubChem CID 141005417) has the molecular formula C32H39NSi and a molecular weight of 465.76 g/mol. Its IUPAC name is N-[dimethyl-(2-methyl-1H-inden-1-yl)silyl]-2-methylpropan-2-amine;[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene.
| Compound Name | N-[dimethyl-(2-methyl-1H-inden-1-yl)silyl]-2-methylpropan-2-amine;[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 141005417 |
| Molecular Formula | C32H39NSi |
| Molecular Weight | 465.76 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | N-[dimethyl-(2-methyl-1H-inden-1-yl)silyl]-2-methylpropan-2-amine;[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene |
| SMILES | C(/C=C/c1ccccc1)=C\c1ccccc1.CC1=Cc2ccccc2C1[Si](C)(C)NC(C)(C)C |
| InChI | InChI=1S/C16H25NSi.C16H14/c1-12-11-13-9-7-8-10-14(13)15(12)18(5,6)17-16(2,3)4;1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h7-11,15,17H,1-6H3;1-14H/b;13-7+,14-8+ |
| InChIKey | MQRHLTVRMTWENL-DGBMRDIKSA-N |
| XLogP | 8.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.76 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|