C41H44Si — CID 173379613
5-[4-(4-tert-butylphenyl)-2-ethyl-1H-inden-1-yl]-9,9-dimethyl-3-phenyl-10-propan-2-yl-9-silatricyclo[6.1.1.02,7]deca-1(10),2,4,6-tetraene (PubChem CID 173379613) has the molecular formula C41H44Si and a molecular weight of 564.89 g/mol. Its IUPAC name is 5-[4-(4-tert-butylphenyl)-2-ethyl-1H-inden-1-yl]-9,9-dimethyl-3-phenyl-10-propan-2-yl-9-silatricyclo[6.1.1.02,7]deca-1(10),2,4,6-tetraene.
| Compound Name | 5-[4-(4-tert-butylphenyl)-2-ethyl-1H-inden-1-yl]-9,9-dimethyl-3-phenyl-10-propan-2-yl-9-silatricyclo[6.1.1.02,7]deca-1(10),2,4,6-tetraene |
|---|---|
| PubChem CID | 173379613 |
| Molecular Formula | C41H44Si |
| Molecular Weight | 564.89 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | 5-[4-(4-tert-butylphenyl)-2-ethyl-1H-inden-1-yl]-9,9-dimethyl-3-phenyl-10-propan-2-yl-9-silatricyclo[6.1.1.02,7]deca-1(10),2,4,6-tetraene |
| SMILES | CCC1=Cc2c(-c3ccc(C(C)(C)C)cc3)cccc2C1c1cc(-c2ccccc2)c2c(c1)C1C(C(C)C)=C2[Si]1(C)C |
| InChI | InChI=1S/C41H44Si/c1-9-26-22-34-31(28-18-20-30(21-19-28)41(4,5)6)16-13-17-32(34)37(26)29-23-33(27-14-11-10-12-15-27)38-35(24-29)39-36(25(2)3)40(38)42(39,7)8/h10-25,37,39H,9H2,1-8H3 |
| InChIKey | IRQUBOYCFAFJHY-UHFFFAOYSA-N |
| XLogP | 11.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.89 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|