C39H42 — CID 157279326
3,6-ditert-butyl-1-(4-phenyl-2-propyl-1H-inden-1-yl)-9H-fluorene (PubChem CID 157279326) has the molecular formula C39H42 and a molecular weight of 510.77 g/mol. Its IUPAC name is 3,6-ditert-butyl-1-(4-phenyl-2-propyl-1H-inden-1-yl)-9H-fluorene.
| Compound Name | 3,6-ditert-butyl-1-(4-phenyl-2-propyl-1H-inden-1-yl)-9H-fluorene |
|---|---|
| PubChem CID | 157279326 |
| Molecular Formula | C39H42 |
| Molecular Weight | 510.77 g/mol |
| Exact Mass | 510.33 |
| IUPAC Name | 3,6-ditert-butyl-1-(4-phenyl-2-propyl-1H-inden-1-yl)-9H-fluorene |
| SMILES | CCCC1=Cc2c(-c3ccccc3)cccc2C1c1cc(C(C)(C)C)cc2c1Cc1ccc(C(C)(C)C)cc1-2 |
| InChI | InChI=1S/C39H42/c1-8-13-27-21-33-30(25-14-10-9-11-15-25)16-12-17-31(33)37(27)36-24-29(39(5,6)7)23-35-32-22-28(38(2,3)4)19-18-26(32)20-34(35)36/h9-12,14-19,21-24,37H,8,13,20H2,1-7H3 |
| InChIKey | GSXFOCJUIFVYRV-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.77 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |