C19H21N — CID 143486580
4-(1,2-dimethyl-1H-inden-4-yl)-N,N-dimethylaniline (PubChem CID 143486580) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 4-(1,2-dimethyl-1H-inden-4-yl)-N,N-dimethylaniline.
| Compound Name | 4-(1,2-dimethyl-1H-inden-4-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 143486580 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 4-(1,2-dimethyl-1H-inden-4-yl)-N,N-dimethylaniline |
| SMILES | CC1=Cc2c(-c3ccc(N(C)C)cc3)cccc2C1C |
| InChI | InChI=1S/C19H21N/c1-13-12-19-17(14(13)2)6-5-7-18(19)15-8-10-16(11-9-15)20(3)4/h5-12,14H,1-4H3 |
| InChIKey | ZLCGQIDZPVDIID-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |