C12H16O2 — CID 123214481
2-(2-ethyl-4-methylphenyl)-1,3-dioxolane (PubChem CID 123214481) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-(2-ethyl-4-methylphenyl)-1,3-dioxolane.
| Compound Name | 2-(2-ethyl-4-methylphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 123214481 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-(2-ethyl-4-methylphenyl)-1,3-dioxolane |
| SMILES | CCc1cc(C)ccc1C1OCCO1 |
| InChI | InChI=1S/C12H16O2/c1-3-10-8-9(2)4-5-11(10)12-13-6-7-14-12/h4-5,8,12H,3,6-7H2,1-2H3 |
| InChIKey | HYPOTDCYUVBOGW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |