C16H12ClNO2 — CID 174489602
2-(4-chlorophenyl)-6-methyl-4H-3,1-benzoxazine-4-carbaldehyde (PubChem CID 174489602) has the molecular formula C16H12ClNO2 and a molecular weight of 285.73 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-methyl-4H-3,1-benzoxazine-4-carbaldehyde.
| Compound Name | 2-(4-chlorophenyl)-6-methyl-4H-3,1-benzoxazine-4-carbaldehyde |
|---|---|
| PubChem CID | 174489602 |
| Molecular Formula | C16H12ClNO2 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-(4-chlorophenyl)-6-methyl-4H-3,1-benzoxazine-4-carbaldehyde |
| SMILES | Cc1ccc2c(c1)C(C=O)OC(c1ccc(Cl)cc1)=N2 |
| InChI | InChI=1S/C16H12ClNO2/c1-10-2-7-14-13(8-10)15(9-19)20-16(18-14)11-3-5-12(17)6-4-11/h2-9,15H,1H3 |
| InChIKey | LZUBHJWHIJWKMS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|