C20H15NO2 — CID 174526090
6-methyl-2-naphthalen-1-yl-4H-3,1-benzoxazine-4-carbaldehyde (PubChem CID 174526090) has the molecular formula C20H15NO2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 6-methyl-2-naphthalen-1-yl-4H-3,1-benzoxazine-4-carbaldehyde.
| Compound Name | 6-methyl-2-naphthalen-1-yl-4H-3,1-benzoxazine-4-carbaldehyde |
|---|---|
| PubChem CID | 174526090 |
| Molecular Formula | C20H15NO2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 6-methyl-2-naphthalen-1-yl-4H-3,1-benzoxazine-4-carbaldehyde |
| SMILES | Cc1ccc2c(c1)C(C=O)OC(c1cccc3ccccc13)=N2 |
| InChI | InChI=1S/C20H15NO2/c1-13-9-10-18-17(11-13)19(12-22)23-20(21-18)16-8-4-6-14-5-2-3-7-15(14)16/h2-12,19H,1H3 |
| InChIKey | JKMAQFUPSZBJTJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|