C15H9N3O6 — CID 174503864
2-(2,4-dinitrophenyl)-4H-3,1-benzoxazine-4-carbaldehyde (PubChem CID 174503864) has the molecular formula C15H9N3O6 and a molecular weight of 327.25 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-4H-3,1-benzoxazine-4-carbaldehyde.
| Compound Name | 2-(2,4-dinitrophenyl)-4H-3,1-benzoxazine-4-carbaldehyde |
|---|---|
| PubChem CID | 174503864 |
| Molecular Formula | C15H9N3O6 |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 2-(2,4-dinitrophenyl)-4H-3,1-benzoxazine-4-carbaldehyde |
| SMILES | O=CC1OC(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])=Nc2ccccc21 |
| InChI | InChI=1S/C15H9N3O6/c19-8-14-10-3-1-2-4-12(10)16-15(24-14)11-6-5-9(17(20)21)7-13(11)18(22)23/h1-8,14H |
| InChIKey | ACLKSNZMOOJBEO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 124.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|