C29H18Br2N2O — CID 141218739
2-(3,5-dibromophenyl)-4,6-dinaphthalen-1-yl-2H-1,3,5-oxadiazine (PubChem CID 141218739) has the molecular formula C29H18Br2N2O and a molecular weight of 570.28 g/mol. Its IUPAC name is 2-(3,5-dibromophenyl)-4,6-dinaphthalen-1-yl-2H-1,3,5-oxadiazine.
| Compound Name | 2-(3,5-dibromophenyl)-4,6-dinaphthalen-1-yl-2H-1,3,5-oxadiazine |
|---|---|
| PubChem CID | 141218739 |
| Molecular Formula | C29H18Br2N2O |
| Molecular Weight | 570.28 g/mol |
| Exact Mass | 567.98 |
| IUPAC Name | 2-(3,5-dibromophenyl)-4,6-dinaphthalen-1-yl-2H-1,3,5-oxadiazine |
| SMILES | Brc1cc(Br)cc(C2N=C(c3cccc4ccccc34)N=C(c3cccc4ccccc34)O2)c1 |
| InChI | InChI=1S/C29H18Br2N2O/c30-21-15-20(16-22(31)17-21)28-32-27(25-13-5-9-18-7-1-3-11-23(18)25)33-29(34-28)26-14-6-10-19-8-2-4-12-24(19)26/h1-17,28H |
| InChIKey | FWYGSHOQEVCPQJ-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.28 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |