C10H8BrNO2 — CID 174482702
6-bromo-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde (PubChem CID 174482702) has the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. Its IUPAC name is 6-bromo-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde.
| Compound Name | 6-bromo-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde |
|---|---|
| PubChem CID | 174482702 |
| Molecular Formula | C10H8BrNO2 |
| Molecular Weight | 254.08 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | 6-bromo-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde |
| SMILES | CC1=Nc2ccc(Br)cc2C(C=O)O1 |
| InChI | InChI=1S/C10H8BrNO2/c1-6-12-9-3-2-7(11)4-8(9)10(5-13)14-6/h2-5,10H,1H3 |
| InChIKey | MIPGAQQHNSUSBP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.08 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|