C15H13ClO2 — CID 167666261
2-chloro-6,8-dimethyl-6H-benzo[c]chromen-3-ol (PubChem CID 167666261) has the molecular formula C15H13ClO2 and a molecular weight of 260.72 g/mol. Its IUPAC name is 2-chloro-6,8-dimethyl-6H-benzo[c]chromen-3-ol.
| Compound Name | 2-chloro-6,8-dimethyl-6H-benzo[c]chromen-3-ol |
|---|---|
| PubChem CID | 167666261 |
| Molecular Formula | C15H13ClO2 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 2-chloro-6,8-dimethyl-6H-benzo[c]chromen-3-ol |
| SMILES | Cc1ccc2c(c1)C(C)Oc1cc(O)c(Cl)cc1-2 |
| InChI | InChI=1S/C15H13ClO2/c1-8-3-4-10-11(5-8)9(2)18-15-7-14(17)13(16)6-12(10)15/h3-7,9,17H,1-2H3 |
| InChIKey | QMTIYJBYLMEKLB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |