C16H13N — CID 149236608
7,9-dimethyl-9H-fluorene-2-carbonitrile (PubChem CID 149236608) has the molecular formula C16H13N and a molecular weight of 219.29 g/mol. Its IUPAC name is 7,9-dimethyl-9H-fluorene-2-carbonitrile.
| Compound Name | 7,9-dimethyl-9H-fluorene-2-carbonitrile |
|---|---|
| PubChem CID | 149236608 |
| Molecular Formula | C16H13N |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 7,9-dimethyl-9H-fluorene-2-carbonitrile |
| SMILES | Cc1ccc2c(c1)C(C)c1cc(C#N)ccc1-2 |
| InChI | InChI=1S/C16H13N/c1-10-3-5-13-14-6-4-12(9-17)8-16(14)11(2)15(13)7-10/h3-8,11H,1-2H3 |
| InChIKey | XLIRSTWTPKYUOK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |