C15H13NO — CID 13415173
3-(2,5-dimethylphenyl)-4-hydroxybenzonitrile (PubChem CID 13415173) has the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-4-hydroxybenzonitrile.
| Compound Name | 3-(2,5-dimethylphenyl)-4-hydroxybenzonitrile |
|---|---|
| PubChem CID | 13415173 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-4-hydroxybenzonitrile |
| SMILES | Cc1ccc(C)c(-c2cc(C#N)ccc2O)c1 |
| InChI | InChI=1S/C15H13NO/c1-10-3-4-11(2)13(7-10)14-8-12(9-16)5-6-15(14)17/h3-8,17H,1-2H3 |
| InChIKey | QVJPDHMQJDCIMM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |