C11H8O3 — CID 54426714
7-methyl-3-methylidenechromene-2,4-dione (PubChem CID 54426714) has the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. Its IUPAC name is 7-methyl-3-methylidenechromene-2,4-dione.
| Compound Name | 7-methyl-3-methylidenechromene-2,4-dione |
|---|---|
| PubChem CID | 54426714 |
| Molecular Formula | C11H8O3 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 7-methyl-3-methylidenechromene-2,4-dione |
| SMILES | C=C1C(=O)Oc2cc(C)ccc2C1=O |
| InChI | InChI=1S/C11H8O3/c1-6-3-4-8-9(5-6)14-11(13)7(2)10(8)12/h3-5H,2H2,1H3 |
| InChIKey | WEPUVIXBTFCYGS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|