C20H22N2O — CID 138057456
2-(4-cyclobutylphenyl)-3,6-dimethyl-1,2-dihydroquinazolin-4-one (PubChem CID 138057456) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-(4-cyclobutylphenyl)-3,6-dimethyl-1,2-dihydroquinazolin-4-one.
| Compound Name | 2-(4-cyclobutylphenyl)-3,6-dimethyl-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 138057456 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-(4-cyclobutylphenyl)-3,6-dimethyl-1,2-dihydroquinazolin-4-one |
| SMILES | Cc1ccc2c(c1)C(=O)N(C)C(c1ccc(C3CCC3)cc1)N2 |
| InChI | InChI=1S/C20H22N2O/c1-13-6-11-18-17(12-13)20(23)22(2)19(21-18)16-9-7-15(8-10-16)14-4-3-5-14/h6-12,14,19,21H,3-5H2,1-2H3 |
| InChIKey | KRTVHKBYUVKTPM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |