C13H13NO5 — CID 67154056
carbonic acid;5-cyclobutyl-1H-indole-2,3-dione (PubChem CID 67154056) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is carbonic acid;5-cyclobutyl-1H-indole-2,3-dione.
| Compound Name | carbonic acid;5-cyclobutyl-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 67154056 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | carbonic acid;5-cyclobutyl-1H-indole-2,3-dione |
| SMILES | O=C(O)O.O=C1Nc2ccc(C3CCC3)cc2C1=O |
| InChI | InChI=1S/C12H11NO2.CH2O3/c14-11-9-6-8(7-2-1-3-7)4-5-10(9)13-12(11)15;2-1(3)4/h4-7H,1-3H2,(H,13,14,15);(H2,2,3,4) |
| InChIKey | XFTIJQNZBGGMBD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|