About (3Z)-5-bromo-3-(1,2,4-triazol-4-ylimino)-1H-indol-2-one
(3Z)-5-bromo-3-(1,2,4-triazol-4-ylimino)-1H-indol-2-one (PubChem CID 135703568) has the molecular formula C10H6BrN5O
and a molecular weight of 292.10 g/mol. Its IUPAC name is (3Z)-5-bromo-3-(1,2,4-triazol-4-ylimino)-1H-indol-2-one.
Molecular Properties
| Compound Name | (3Z)-5-bromo-3-(1,2,4-triazol-4-ylimino)-1H-indol-2-one |
| PubChem CID | 135703568 |
| Molecular Formula | C10H6BrN5O |
| Molecular Weight | 292.10 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | (3Z)-5-bromo-3-(1,2,4-triazol-4-ylimino)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(Br)cc2/C1=N/n1cnnc1 |
| InChI | InChI=1S/C10H6BrN5O/c11-6-1-2-8-7(3-6)9(10(17)14-8)15-16-4-12-13-5-16/h1-5H,(H,14,15,17) |
| InChIKey | FUYVDOXVEZAPHU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.10 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5-bromo-3-(1,2,4-triazol-4-ylimino)-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5-bromo-3-(1,2,4-triazol-4-ylimino)-1H-indol-2-one?
The IUPAC name of (3Z)-5-bromo-3-(1,2,4-triazol-4-ylimino)-1H-indol-2-one (CID 135703568) is (3Z)-5-bromo-3-(1,2,4-triazol-4-ylimino)-1H-indol-2-one.
What is the SMILES notation for (3Z)-5-bromo-3-(1,2,4-triazol-4-ylimino)-1H-indol-2-one?
The canonical SMILES for (3Z)-5-bromo-3-(1,2,4-triazol-4-ylimino)-1H-indol-2-one is O=C1Nc2ccc(Br)cc2/C1=N/n1cnnc1.
What is the InChIKey of (3Z)-5-bromo-3-(1,2,4-triazol-4-ylimino)-1H-indol-2-one?
The InChIKey is FUYVDOXVEZAPHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrN5O/c11-6-1-2-8-7(3-6)9(10(17)14-8)15-16-4-12-13-5-16/h1-5H,(H,14,15,17).
What are the key properties of (3Z)-5-bromo-3-(1,2,4-triazol-4-ylimino)-1H-indol-2-one?
(3Z)-5-bromo-3-(1,2,4-triazol-4-ylimino)-1H-indol-2-one has a molecular weight of 292.10 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5-bromo-3-(1,2,4-triazol-4-ylimino)-1H-indol-2-one is sourced from PubChem (CID 135703568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).