C17H10NNaO8S2 — CID 157420375
sodium (2Z)-3-oxo-2-(3-oxo-5-sulfo-1H-indol-2-ylidene)-1H-indene-5-sulfonate (PubChem CID 157420375) has the molecular formula C17H10NNaO8S2 and a molecular weight of 443.39 g/mol. Its IUPAC name is sodium (2Z)-3-oxo-2-(3-oxo-5-sulfo-1H-indol-2-ylidene)-1H-indene-5-sulfonate.
| Compound Name | sodium (2Z)-3-oxo-2-(3-oxo-5-sulfo-1H-indol-2-ylidene)-1H-indene-5-sulfonate |
|---|---|
| PubChem CID | 157420375 |
| Molecular Formula | C17H10NNaO8S2 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 442.97 |
| IUPAC Name | sodium (2Z)-3-oxo-2-(3-oxo-5-sulfo-1H-indol-2-ylidene)-1H-indene-5-sulfonate |
| SMILES | O=C1/C(=C2\Nc3ccc(S(=O)(=O)O)cc3C2=O)Cc2ccc(S(=O)(=O)[O-])cc21.[Na+] |
| InChI | InChI=1S/C17H11NO8S2.Na/c19-16-11-6-9(27(21,22)23)2-1-8(11)5-13(16)15-17(20)12-7-10(28(24,25)26)3-4-14(12)18-15;/h1-4,6-7,18H,5H2,(H,21,22,23)(H,24,25,26);/q;+1/p-1/b15-13-; |
| InChIKey | BAZBDOZTYKNJLC-ZDCVYKBASA-M |
| XLogP | -1.86 |
| TPSA | 157.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|